cas: 1101120-35-7 — see every product listed under this CAS number, including other names
Ethyl 5-aminopyrazolo[1,5-a]pyridine-3-carboxylate 95% (CAS 1101120-35-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A942209-250mg |
| cas | 1101120-35-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1143.56 Pln | |
| Ambeed | 10g | 1905.62 Pln | |
| Ambeed | 25g | 3841.38 Pln | |
| Ambeed | 100g | 12135.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A942209 |
Ethyl 5-aminopyrazolo[1,5-a]pyridine-3-carboxylate (CAS 1101120-35-7) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: ethyl 5-aminopyrazolo[1,5-a]pyridine-3-carboxylate. InChIKey: PEZWWKGGTIYZPN-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | ethyl 5-aminopyrazolo[1,5-a]pyridine-3-carboxylate |
| InChIKey | PEZWWKGGTIYZPN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C=C(C=CN2N=C1)N |
Computed by PubChem (NCBI)