Ethyl 5-Bromobenzofuran-3-Carboxylate, 98%
cas: 137242-41-2 — see every product listed under this CAS number, including other names
Ethyl 5-Bromobenzofuran-3-Carboxylate, 98% (CAS 137242-41-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 50mg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1123ZN-100mg |
| cas | 137242-41-2 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 770.00 Pln | |
| Chemat | 250mg | 1077.20 Pln | |
| Chemat | 500mg | 1653.20 Pln | |
| Chemat | 1g | 2109.20 Pln | |
| Chemat | 5g | 8243.60 Pln | |
| Fluorochem | 100mg | 997.58 Pln | |
| Fluorochem | 250mg | 1414.10 Pln | |
| Fluorochem | 500mg | 2169.05 Pln | |
| Fluorochem | 1g | 2767.79 Pln | |
| Fluorochem | 5g | 10582.75 Pln | |
| Fluorochem | 10g | 21115.50 Pln | |
| Fluorochem | 50mg | 695.61 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-bromo-1-benzofuran-3-carboxylate (CAS 137242-41-2) is a chemical compound with the molecular formula C11H9BrO3 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl 5-bromo-1-benzofuran-3-carboxylate. InChIKey: ZBKAUMXETAHVCI-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO3 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl 5-bromo-1-benzofuran-3-carboxylate |
| InChIKey | ZBKAUMXETAHVCI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=COC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)