CAS 104093-34-7 is the registry number for (E)-Methyl-4-(4-bromophenyl)-2-oxobut-3-enoate, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 10g, 1g.
Methyl 4-(4-bromophenyl)-2-oxobut-3-enoate (CAS 104093-34-7) is a chemical compound with the molecular formula C11H9BrO3 and a molecular weight of 269.09 g/mol. IUPAC name: methyl 4-(4-bromophenyl)-2-oxobut-3-enoate. InChIKey: OEKODHJXUIKZME-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO3 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | methyl 4-(4-bromophenyl)-2-oxobut-3-enoate |
| InChIKey | OEKODHJXUIKZME-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C=CC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)