Products 1273602-53-1
CAS 1273602-53-1 appears in our catalog under these names: 3-Bromo-5-oxo-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid, 95%, 3–Bromo–5–oxo–5，6，7，8–tetrahydronaphthalene–1–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
3-bromo-5-oxo-7,8-dihydro-6H-naphthalene-1-carboxylic acid (CAS 1273602-53-1) is a chemical compound with the molecular formula C11H9BrO3 and a molecular weight of 269.09 g/mol. IUPAC name: 3-bromo-5-oxo-7,8-dihydro-6H-naphthalene-1-carboxylic acid. InChIKey: GXGHYUYUTLETRT-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO3 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 3-bromo-5-oxo-7,8-dihydro-6H-naphthalene-1-carboxylic acid |
| InChIKey | GXGHYUYUTLETRT-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2C(=O)O)Br)C(=O)C1 |
Computed by PubChem (NCBI)