cas: 105191-13-7 — see every product listed under this CAS number, including other names
Ethyl 5-cyanoindole-2-carboxylate 98% (CAS 105191-13-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A300143-250mg |
| cas | 105191-13-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 576.19 Pln | |
| Ambeed | 10g | 1082.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A300143 |
Ethyl 5-cyano-1H-indole-2-carboxylate (CAS 105191-13-7) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: ethyl 5-cyano-1H-indole-2-carboxylate. InChIKey: VZSOXWAHGVEQOT-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | ethyl 5-cyano-1H-indole-2-carboxylate |
| InChIKey | VZSOXWAHGVEQOT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)C#N |
Computed by PubChem (NCBI)