cas: 1269026-22-3 — see every product listed under this CAS number, including other names
Ethyl 6-Bromo-3-hydroxy-5-methylpyrazine-2-carboxylate, 98%, 98% (CAS 1269026-22-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FNII-100mg |
| cas | 1269026-22-3 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 25g | 870.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-bromo-6-methyl-2-oxo-1H-pyrazine-3-carboxylate (CAS 1269026-22-3) is a chemical compound with the molecular formula C8H9BrN2O3 and a molecular weight of 261.07 g/mol. IUPAC name: ethyl 5-bromo-6-methyl-2-oxo-1H-pyrazine-3-carboxylate. InChIKey: POYHGPKBZHOUBJ-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O3 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | ethyl 5-bromo-6-methyl-2-oxo-1H-pyrazine-3-carboxylate |
| InChIKey | POYHGPKBZHOUBJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=C(NC1=O)C)Br |
Computed by PubChem (NCBI)