cas: 171876-22-5 — see every product listed under this CAS number, including other names
Ethyl 6-chloro-5-nitronicotinate 97% (CAS 171876-22-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A158552-100mg |
| cas | 171876-22-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 882.12 Pln | |
| Ambeed | 10g | 1638.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A158552 |
Ethyl 6-chloro-5-nitropyridine-3-carboxylate (CAS 171876-22-5) is a chemical compound with the molecular formula C8H7ClN2O4 and a molecular weight of 230.60 g/mol. IUPAC name: ethyl 6-chloro-5-nitropyridine-3-carboxylate. InChIKey: RJGYARAKIVLQAQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O4 |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | ethyl 6-chloro-5-nitropyridine-3-carboxylate |
| InChIKey | RJGYARAKIVLQAQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(N=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)