cas: 863250-72-0 — see every product listed under this CAS number, including other names
Ethyl 6-fluorobenzofuran-3-carboxylate, 95%+, 95%+ (CAS 863250-72-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JGAZ-1g |
| cas | 863250-72-0 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 712.40 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 227.60 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
Ethyl 6-fluoro-1-benzofuran-3-carboxylate (CAS 863250-72-0) is a chemical compound with the molecular formula C11H9FO3 and a molecular weight of 208.18 g/mol. IUPAC name: ethyl 6-fluoro-1-benzofuran-3-carboxylate. InChIKey: XJDUTEGNTRIWPL-UHFFFAOYSA-N.
| Molecular formula | C11H9FO3 |
|---|---|
| Molecular weight | 208.18 g/mol |
| IUPAC name | ethyl 6-fluoro-1-benzofuran-3-carboxylate |
| InChIKey | XJDUTEGNTRIWPL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=COC2=C1C=CC(=C2)F |
Computed by PubChem (NCBI)