CAS 2920195-65-7 is the registry number for rel-(2'S,3R)-5-Fluoro-2H-spiro[benzofuran-3,1'-cyclopropane]-2'-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1'S,3R)-5-fluorospiro[2H-1-benzofuran-3,2'-cyclopropane]-1'-carboxylic acid (CAS 2920195-65-7) is a chemical compound with the molecular formula C11H9FO3 and a molecular weight of 208.18 g/mol. IUPAC name: (1'S,3R)-5-fluorospiro[2H-1-benzofuran-3,2'-cyclopropane]-1'-carboxylic acid. InChIKey: FKKOPZZQOBJILB-KCJUWKMLSA-N.
| Molecular formula | C11H9FO3 |
|---|---|
| Molecular weight | 208.18 g/mol |
| IUPAC name | (1'S,3R)-5-fluorospiro[2H-1-benzofuran-3,2'-cyclopropane]-1'-carboxylic acid |
| InChIKey | FKKOPZZQOBJILB-KCJUWKMLSA-N |
| SMILES | C1[C@@H]([C@]12COC3=C2C=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)