Products 1092348-21-4

CAS 1092348-21-4 is the registry number for 3-Fluoro-5-oxo-6,7,8-trihydronaphthalene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-fluoro-5-oxo-7,8-dihydro-6H-naphthalene-2-carboxylic acid (CAS 1092348-21-4) is a chemical compound with the molecular formula C11H9FO3 and a molecular weight of 208.18 g/mol. IUPAC name: 3-fluoro-5-oxo-7,8-dihydro-6H-naphthalene-2-carboxylic acid. InChIKey: RBNZZVKHQPYOGE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9FO3
Molecular weight208.18 g/mol
IUPAC name3-fluoro-5-oxo-7,8-dihydro-6H-naphthalene-2-carboxylic acid
InChIKeyRBNZZVKHQPYOGE-UHFFFAOYSA-N
SMILESC1CC2=CC(=C(C=C2C(=O)C1)F)C(=O)O

Computed by PubChem (NCBI)