cas: 2089334-07-4 — see every product listed under this CAS number, including other names
Ethyl 7-fluoro-2,3-dioxoindoline-6-carboxylate 97% (CAS 2089334-07-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A365514-250mg |
| cas | 2089334-07-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A365514 |
Ethyl 7-fluoro-2,3-dioxo-1H-indole-6-carboxylate (CAS 2089334-07-4) is a chemical compound with the molecular formula C11H8FNO4 and a molecular weight of 237.18 g/mol. IUPAC name: ethyl 7-fluoro-2,3-dioxo-1H-indole-6-carboxylate. InChIKey: DJRXNYFEALSLCS-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO4 |
|---|---|
| Molecular weight | 237.18 g/mol |
| IUPAC name | ethyl 7-fluoro-2,3-dioxo-1H-indole-6-carboxylate |
| InChIKey | DJRXNYFEALSLCS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(C=C1)C(=O)C(=O)N2)F |
Computed by PubChem (NCBI)