Products 932780-62-6
CAS 932780-62-6 appears in our catalog under these names: 5-[(2-Fluorophenoxy)methyl]isoxazole-3-carboxylic acid, 95%, 5-((2-Fluorophenoxy)methyl)isoxazole-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
5-[(2-fluorophenoxy)methyl]-1,2-oxazole-3-carboxylic acid (CAS 932780-62-6) is a chemical compound with the molecular formula C11H8FNO4 and a molecular weight of 237.18 g/mol. IUPAC name: 5-[(2-fluorophenoxy)methyl]-1,2-oxazole-3-carboxylic acid. InChIKey: DBBAKPJCJRFCHW-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO4 |
|---|---|
| Molecular weight | 237.18 g/mol |
| IUPAC name | 5-[(2-fluorophenoxy)methyl]-1,2-oxazole-3-carboxylic acid |
| InChIKey | DBBAKPJCJRFCHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=CC(=NO2)C(=O)O)F |
Computed by PubChem (NCBI)