CAS 66134-67-6 appears in our catalog under these names: 2,5-Dioxopyrrolidin-1-yl 4-fluorobenzoate, 96%, N-Succinimidyl 4-Fluorobenzoate, >98.0%(HPLC)(N), 2,5-Dioxopyrrolidin-1-yl 4-fluorobenzoate 95%, 2,5-Dioxopyrrolidin-1-yl 4-fluorobenzoate, 97%, 97%, 2,5-Dioxopyrrolidin-1-yl 4-fluorobenzoate, 97%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 25g, 250mg, 100mg.
(2,5-dioxopyrrolidin-1-yl) 4-fluorobenzoate (CAS 66134-67-6) is a chemical compound with the molecular formula C11H8FNO4 and a molecular weight of 237.18 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-fluorobenzoate. InChIKey: LSSQMISUDUUZCC-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO4 |
|---|---|
| Molecular weight | 237.18 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-fluorobenzoate |
| InChIKey | LSSQMISUDUUZCC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)