cas: 1353498-59-5 — see every product listed under this CAS number, including other names
Ethyl pyrazolo[1,5-a]pyrimidine-2-carboxylate 98% (CAS 1353498-59-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A655519-250mg |
| cas | 1353498-59-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 2133.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A655519 |
Ethyl pyrazolo[1,5-a]pyrimidine-2-carboxylate (CAS 1353498-59-5) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: ethyl pyrazolo[1,5-a]pyrimidine-2-carboxylate. InChIKey: HDHWFJFNCDMGJK-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | ethyl pyrazolo[1,5-a]pyrimidine-2-carboxylate |
| InChIKey | HDHWFJFNCDMGJK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN2C=CC=NC2=C1 |
Computed by PubChem (NCBI)