cas: 1022920-59-7 — see every product listed under this CAS number, including other names
Ethyl pyrazolo[1,5-a]pyrimidine-6-carboxylate, 98%, 98% (CAS 1022920-59-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11184Y-100mg |
| cas | 1022920-59-7 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 573.20 Pln | |
| Chemat | 5g | 1845.20 Pln | |
| Chemat | 10g | 2766.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl pyrazolo[1,5-a]pyrimidine-6-carboxylate (CAS 1022920-59-7) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: ethyl pyrazolo[1,5-a]pyrimidine-6-carboxylate. InChIKey: BMYWIFFHYYKNFM-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | ethyl pyrazolo[1,5-a]pyrimidine-6-carboxylate |
| InChIKey | BMYWIFFHYYKNFM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C(=CC=N2)N=C1 |
Computed by PubChem (NCBI)