Products 1593673-23-4
CAS 1593673-23-4 appears in our catalog under these names: Etripamil/ 99.83% (existing batch purity), Etripamil, Etripamil, 98.10%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml ethanol).
Methyl 3-[2-[[(4S)-4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]ethyl]benzoate (CAS 1593673-23-4) is a chemical compound with the molecular formula C27H36N2O4 and a molecular weight of 452.6 g/mol. IUPAC name: methyl 3-[2-[[(4S)-4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]ethyl]benzoate. InChIKey: VAZNEHLGJGSQEL-MHZLTWQESA-N.
| Molecular formula | C27H36N2O4 |
|---|---|
| Molecular weight | 452.6 g/mol |
| IUPAC name | methyl 3-[2-[[(4S)-4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]ethyl]benzoate |
| InChIKey | VAZNEHLGJGSQEL-MHZLTWQESA-N |
| SMILES | CC(C)[C@](CCCN(C)CCC1=CC(=CC=C1)C(=O)OC)(C#N)C2=CC(=C(C=C2)OC)OC |
Computed by PubChem (NCBI)