CAS 337972-47-1 appears in our catalog under these names: FAUC 213, FAUC 213/ 99.78% (existing batch purity), FAUC 213, 98%, 98%, FAUC 213, 99.86%, 2-((4-(4-Chlorophenyl)piperazin-1-yl)methyl)pyrazolo[1,5-a]pyridine, 98%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 5mg, 1mg, 5 mg, 10mM/1mL.
2-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]pyrazolo[1,5-a]pyridine (CAS 337972-47-1) is a chemical compound with the molecular formula C18H19ClN4 and a molecular weight of 326.8 g/mol. IUPAC name: 2-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]pyrazolo[1,5-a]pyridine. InChIKey: DTRXURJDKOYCCD-UHFFFAOYSA-N.
| Molecular formula | C18H19ClN4 |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | 2-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]pyrazolo[1,5-a]pyridine |
| InChIKey | DTRXURJDKOYCCD-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=NN3C=CC=CC3=C2)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)