FCPR03
cas: 1917347-65-9 — see every product listed under this CAS number, including other names
FCPR03 (CAS 1917347-65-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg, 100mg, 200mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC65173-1 |
| cas | 1917347-65-9 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 831.06 Pln | |
| GLPBio | 10mg | 2057.36 Pln | |
| GLPBio | 5mg | 1425.49 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1528.46 Pln | |
| Chemat | 1mg | 290.00 Pln | |
| Chemat | 5mg | 626.00 Pln | |
| Chemat | 10mg | 981.20 Pln | |
| Chemat | 25mg | 1562.00 Pln | |
| Chemat | 50mg | 2104.40 Pln | |
| Chemat | 100mg | 2829.20 Pln | |
| Chemat | 200mg | 3794.00 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(cyclopropylmethoxy)-4-(difluoromethoxy)-N-propan-2-ylbenzamide (CAS 1917347-65-9) is a chemical compound with the molecular formula C15H19F2NO3 and a molecular weight of 299.31 g/mol. IUPAC name: 3-(cyclopropylmethoxy)-4-(difluoromethoxy)-N-propan-2-ylbenzamide. InChIKey: DLTIJXDCEGNJEW-UHFFFAOYSA-N.
| Molecular formula | C15H19F2NO3 |
|---|---|
| Molecular weight | 299.31 g/mol |
| IUPAC name | 3-(cyclopropylmethoxy)-4-(difluoromethoxy)-N-propan-2-ylbenzamide |
| InChIKey | DLTIJXDCEGNJEW-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC(=C(C=C1)OC(F)F)OCC2CC2 |
Computed by PubChem (NCBI)