Products 1551509-92-2
CAS 1551509-92-2 is the registry number for tert-Butyl 3-(2,6-difluoro-3-methylphenyl)-3-hydroxyazetidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(2,6-difluoro-3-methylphenyl)-3-hydroxyazetidine-1-carboxylate (CAS 1551509-92-2) is a chemical compound with the molecular formula C15H19F2NO3 and a molecular weight of 299.31 g/mol. IUPAC name: tert-butyl 3-(2,6-difluoro-3-methylphenyl)-3-hydroxyazetidine-1-carboxylate. InChIKey: BUXSTLLKRTZDNZ-UHFFFAOYSA-N.
| Molecular formula | C15H19F2NO3 |
|---|---|
| Molecular weight | 299.31 g/mol |
| IUPAC name | tert-butyl 3-(2,6-difluoro-3-methylphenyl)-3-hydroxyazetidine-1-carboxylate |
| InChIKey | BUXSTLLKRTZDNZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C2(CN(C2)C(=O)OC(C)(C)C)O)F |
Computed by PubChem (NCBI)