CAS 388071-27-0 appears in our catalog under these names: Erythro-n-boc-3,5-difluoro-l-phenylalanine epoxide, 95%, tert-Butyl ((S)-2-(3,5-difluorophenyl)-1-((S)-oxiran-2-yl)ethyl)carbamate, 95+%, erythro-N-Boc-3,5-difluoro-L-phenylalanine epoxide, 95% . Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar). Available pack sizes: 250mg, 1g.
Tert-butyl N-[(1S)-2-(3,5-difluorophenyl)-1-[(2S)-oxiran-2-yl]ethyl]carbamate (CAS 388071-27-0) is a chemical compound with the molecular formula C15H19F2NO3 and a molecular weight of 299.31 g/mol. IUPAC name: tert-butyl N-[(1S)-2-(3,5-difluorophenyl)-1-[(2S)-oxiran-2-yl]ethyl]carbamate. InChIKey: NKGKCDXMOMAORK-QWHCGFSZSA-N.
| Molecular formula | C15H19F2NO3 |
|---|---|
| Molecular weight | 299.31 g/mol |
| IUPAC name | tert-butyl N-[(1S)-2-(3,5-difluorophenyl)-1-[(2S)-oxiran-2-yl]ethyl]carbamate |
| InChIKey | NKGKCDXMOMAORK-QWHCGFSZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=CC(=C1)F)F)[C@H]2CO2 |
Computed by PubChem (NCBI)