CAS 1266684-01-8 appears in our catalog under these names: FIDAS–3, FIDAS-3/ 98.59% (existing batch purity), FIDAS-3, (E)-4-(2,6-Difluorostyryl)-N,N-dimethylaniline, FIDAS-3, 99.40%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 500mg, 200mg.
4-[(E)-2-(2,6-difluorophenyl)ethenyl]-N,N-dimethylaniline (CAS 1266684-01-8) is a chemical compound with the molecular formula C16H15F2N and a molecular weight of 259.29 g/mol. IUPAC name: 4-[(E)-2-(2,6-difluorophenyl)ethenyl]-N,N-dimethylaniline. InChIKey: YBJDCOLXJYDHOM-DHZHZOJOSA-N.
| Molecular formula | C16H15F2N |
|---|---|
| Molecular weight | 259.29 g/mol |
| IUPAC name | 4-[(E)-2-(2,6-difluorophenyl)ethenyl]-N,N-dimethylaniline |
| InChIKey | YBJDCOLXJYDHOM-DHZHZOJOSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C/C2=C(C=CC=C2F)F |
Computed by PubChem (NCBI)