Products 2118944-88-8
CAS 2118944-88-8 appears in our catalog under these names: FL-411/ 96.23% (existing batch purity), FL–411 (BRD4–IN–1), FL 411, FL-411 97%, FL 411, 95%, 95%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
5-(4-hydroxy-3,5-dimethylphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (CAS 2118944-88-8) is a chemical compound with the molecular formula C18H19N3O2S and a molecular weight of 341.4 g/mol. IUPAC name: 5-(4-hydroxy-3,5-dimethylphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one. InChIKey: PXJZRFLBUBYEPV-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O2S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 5-(4-hydroxy-3,5-dimethylphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| InChIKey | PXJZRFLBUBYEPV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)C2=NC3=C(C4=C(S3)CN(CC4)C)C(=O)N2 |
Computed by PubChem (NCBI)