cas: 199915-38-3 — see every product listed under this CAS number, including other names
FMOC isothiocyanate, 97% (CAS 199915-38-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 438660010 |
| cas | 199915-38-3 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 538.99 Pln | |
| Thermo Scientific (Acros) | 5g | 1830.78 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
9H-fluoren-9-ylmethyl N-(sulfanylidenemethylidene)carbamate (CAS 199915-38-3) is a chemical compound with the molecular formula C16H11NO2S and a molecular weight of 281.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(sulfanylidenemethylidene)carbamate. InChIKey: DHMYULZVFHHEHE-UHFFFAOYSA-N.
| Molecular formula | C16H11NO2S |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(sulfanylidenemethylidene)carbamate |
| InChIKey | DHMYULZVFHHEHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N=C=S |
Computed by PubChem (NCBI)