Faropenem sodium 98%
cas: 122547-49-3 — see every product listed under this CAS number, including other names
Faropenem sodium 98% (CAS 122547-49-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A396403-5g |
| cas | 122547-49-3 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 5042.88 Pln | |
| Ambeed | 10g | 8024.38 Pln | |
| Ambeed | 1mg | 175.69 Pln | |
| Ambeed | 5mg | 197.94 Pln | |
| Ambeed | 10mg | 259.12 Pln | |
| Ambeed | 25mg | 409.31 Pln | |
| Ambeed | 50mg | 559.50 Pln | |
| Ambeed | 100mg | 654.06 Pln | |
| Ambeed | 250mg | 948.88 Pln | |
| Ambeed | 1g | 1488.44 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A396403 |
Sodium (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[(2R)-oxolan-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (CAS 122547-49-3) is a chemical compound with the molecular formula C12H14NNaO5S and a molecular weight of 307.30 g/mol. IUPAC name: sodium (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[(2R)-oxolan-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate. InChIKey: ICSAXRANXQSPQP-VUKDEKJYSA-M.
| Molecular formula | C12H14NNaO5S |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | sodium (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[(2R)-oxolan-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| InChIKey | ICSAXRANXQSPQP-VUKDEKJYSA-M |
| SMILES | C[C@H]([C@@H]1[C@@H]2N(C1=O)C(=C(S2)[C@H]3CCCO3)C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)