Faropenem sodium, 98%, 98%
cas: 122547-49-3 — see every product listed under this CAS number, including other names
Faropenem sodium, 98%, 98% (CAS 122547-49-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HGRX-1mg |
| cas | 122547-49-3 |
| size | 1mg |
| availability | 50g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 155.60 Pln | |
| Chemat | 5mg | 174.80 Pln | |
| Chemat | 10mg | 213.20 Pln | |
| Chemat | 25mg | 290.00 Pln | |
| Chemat | 50mg | 357.20 Pln | |
| Chemat | 100mg | 448.40 Pln | |
| Chemat | 250mg | 640.40 Pln | |
| Chemat | 1g | 1221.20 Pln | |
| Chemat | 5g | 4115.60 Pln | |
| Chemat | 10g | 6544.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Sodium (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[(2R)-oxolan-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (CAS 122547-49-3) is a chemical compound with the molecular formula C12H14NNaO5S and a molecular weight of 307.30 g/mol. IUPAC name: sodium (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[(2R)-oxolan-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate. InChIKey: ICSAXRANXQSPQP-VUKDEKJYSA-M.
| Molecular formula | C12H14NNaO5S |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | sodium (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[(2R)-oxolan-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| InChIKey | ICSAXRANXQSPQP-VUKDEKJYSA-M |
| SMILES | C[C@H]([C@@H]1[C@@H]2N(C1=O)C(=C(S2)[C@H]3CCCO3)C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)