CAS 122547-49-3 appears in our catalog under these names: Faropenem Sodium Salt, Faropenem sodium/ 99.31% (existing batch purity), Faropenem sodium, Faropenem sodium hydrate, Faropenem sodium salt, 97.50%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Thermo Scientific (Acros). Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso), 1g.
Sodium (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[(2R)-oxolan-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (CAS 122547-49-3) is a chemical compound with the molecular formula C12H14NNaO5S and a molecular weight of 307.30 g/mol. IUPAC name: sodium (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[(2R)-oxolan-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate. InChIKey: ICSAXRANXQSPQP-VUKDEKJYSA-M.
| Molecular formula | C12H14NNaO5S |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | sodium (5R,6S)-6-[(1R)-1-hydroxyethyl]-7-oxo-3-[(2R)-oxolan-2-yl]-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| InChIKey | ICSAXRANXQSPQP-VUKDEKJYSA-M |
| SMILES | C[C@H]([C@@H]1[C@@H]2N(C1=O)C(=C(S2)[C@H]3CCCO3)C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)