Products 1286448-08-5
CAS 1286448-08-5 appears in our catalog under these names: Flunitrazepam-D7, Flunitrazepam-D7 0.1 mg/ml in Methanol, Flunitrazepam-D7, 0.1mg/ml in Methanol, Flunitrazepam-D7, 1mg/ml in Methanol, Flunitrazepam–d7 (CRM). Offered by: Lipomed, LoGiCal, GLPBio, Biosynth. Available pack sizes: 50mg, 100mg, 10mg, 1ml, 100μg, 5mg, 25mg.
7-nitro-5-(2,3,4,5-tetradeuterio-6-fluorophenyl)-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one (CAS 1286448-08-5) is a chemical compound with the molecular formula C16H12FN3O3 and a molecular weight of 320.33 g/mol. IUPAC name: 7-nitro-5-(2,3,4,5-tetradeuterio-6-fluorophenyl)-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one. InChIKey: PPTYJKAXVCCBDU-AAYPNNLASA-N.
| Molecular formula | C16H12FN3O3 |
|---|---|
| Molecular weight | 320.33 g/mol |
| IUPAC name | 7-nitro-5-(2,3,4,5-tetradeuterio-6-fluorophenyl)-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one |
| InChIKey | PPTYJKAXVCCBDU-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C2=NCC(=O)N(C3=C2C=C(C=C3)[N+](=O)[O-])C([2H])([2H])[2H])F)[2H])[2H] |
Computed by PubChem (NCBI)