Fmoc-Ăź-HomoThr(tBu)-OH, 97%
cas: 353245-99-5 — see every product listed under this CAS number, including other names
Fmoc-Ăź-HomoThr(tBu)-OH, 97% (CAS 353245-99-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M06215-100MG |
| cas | 353245-99-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 581.06 Pln | |
| Fluorochem | 5g | 2450.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]pentanoic acid (CAS 353245-99-5) is a chemical compound with the molecular formula C24H29NO5 and a molecular weight of 411.5 g/mol. IUPAC name: (3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]pentanoic acid. InChIKey: UFJMOCVIPRJMLW-QVKFZJNVSA-N.
| Molecular formula | C24H29NO5 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | (3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]pentanoic acid |
| InChIKey | UFJMOCVIPRJMLW-QVKFZJNVSA-N |
| SMILES | C[C@H]([C@@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C |
Computed by PubChem (NCBI)