cas: 353245-99-5 — see every product listed under this CAS number, including other names
Fmoc-β-HomoThr(tBu)-OH, 97%, 97% (CAS 353245-99-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118DPG-100mg |
| cas | 353245-99-5 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 496.40 Pln | |
| Chemat | 5g | 1581.20 Pln | |
| Chemat | 25g | 6290.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]pentanoic acid (CAS 353245-99-5) is a chemical compound with the molecular formula C24H29NO5 and a molecular weight of 411.5 g/mol. IUPAC name: (3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]pentanoic acid. InChIKey: UFJMOCVIPRJMLW-QVKFZJNVSA-N.
| Molecular formula | C24H29NO5 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | (3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]pentanoic acid |
| InChIKey | UFJMOCVIPRJMLW-QVKFZJNVSA-N |
| SMILES | C[C@H]([C@@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C |
Computed by PubChem (NCBI)