Products 353245-99-5
CAS 353245-99-5 appears in our catalog under these names: Fmoc-l-beta-homothreonine(otbu), 95%, Fmoc-β-HoThr(tBu)-OH 97%, Fmoc-β-HomoThr(tBu)-OH, 97%, 97%, Fmoc-ß-HomoThr(tBu)-OH, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 25g.
(3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]pentanoic acid (CAS 353245-99-5) is a chemical compound with the molecular formula C24H29NO5 and a molecular weight of 411.5 g/mol. IUPAC name: (3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]pentanoic acid. InChIKey: UFJMOCVIPRJMLW-QVKFZJNVSA-N.
| Molecular formula | C24H29NO5 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | (3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]pentanoic acid |
| InChIKey | UFJMOCVIPRJMLW-QVKFZJNVSA-N |
| SMILES | C[C@H]([C@@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C |
Computed by PubChem (NCBI)