cas: 285996-74-9 — see every product listed under this CAS number, including other names
Fmoc-1-amino-4-oxo-cyclohexanecarboxylicacid 96% (CAS 285996-74-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A684317-100mg |
| cas | 285996-74-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 503.88 Pln | |
| Ambeed | 250mg | 820.94 Pln | |
| Ambeed | 1g | 2111.44 Pln | |
| Ambeed | 5g | 7145.50 Pln | |
| Ambeed | 10g | 12619.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A684317 |
1-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxocyclohexane-1-carboxylic acid (CAS 285996-74-9) is a chemical compound with the molecular formula C22H21NO5 and a molecular weight of 379.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxocyclohexane-1-carboxylic acid. InChIKey: SHBYYFRMCILKOK-UHFFFAOYSA-N.
| Molecular formula | C22H21NO5 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxocyclohexane-1-carboxylic acid |
| InChIKey | SHBYYFRMCILKOK-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1=O)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)