cas: 185116-43-2 — see every product listed under this CAS number, including other names
Fmoc-4-Abz-OH 98% (CAS 185116-43-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A408990-1g |
| cas | 185116-43-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 882.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A408990 |
4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 185116-43-2) is a chemical compound with the molecular formula C22H17NO4 and a molecular weight of 359.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: VGSYYBSAOANSLR-UHFFFAOYSA-N.
| Molecular formula | C22H17NO4 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| InChIKey | VGSYYBSAOANSLR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)