Products 185116-42-1
CAS 185116-42-1 appears in our catalog under these names: Fmoc-3-aminobenzoic acid, 98%, Fmoc–3–Abz–OH, Fmoc-3-Abz-OH, Fmoc-3-Abz-OH 98%, FMOC-3-ABZ-OH, >=98.0%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 5g, 100g, 1g, 2.5G.
3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 185116-42-1) is a chemical compound with the molecular formula C22H17NO4 and a molecular weight of 359.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: VFXDSSUGFNVDJP-UHFFFAOYSA-N.
| Molecular formula | C22H17NO4 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| InChIKey | VFXDSSUGFNVDJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=CC(=C4)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-3-Abz-OH, Fmoc-3-aminobenzoic acid, 3-(Fmoc-amino)benzoic acid, 3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic Acid, 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)benzoic acid, Fmoc-3-Abz-OH, >=98.0% (HPLC), Fmoc - 3 - aminobenzoic acid, Fmoc-(3)Abz-OH, 3-[(fluoren-9-ylmethoxy)carbonylamino]benzoic acid