CAS 185116-43-2 appears in our catalog under these names: Fmoc–4–Abz–OH, Fmoc-4-Abz-OH, 4-(Fmoc-amino)benzoic acid, 97% , Fmoc-4-Abz-OH 98%, FMOC-4-ABZ-OH, >=96.0%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 5g, 1g, 250mg, 100g, 50g, 10g.
4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 185116-43-2) is a chemical compound with the molecular formula C22H17NO4 and a molecular weight of 359.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: VGSYYBSAOANSLR-UHFFFAOYSA-N.
| Molecular formula | C22H17NO4 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| InChIKey | VGSYYBSAOANSLR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)