cas: 166108-71-0 — see every product listed under this CAS number, including other names
Fmoc-AEEA-OH 98% (CAS 166108-71-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A315456-100mg |
| cas | 166108-71-0 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 231.31 Pln | |
| Ambeed | 25g | 409.31 Pln | |
| Ambeed | 100g | 1371.62 Pln | |
| Ambeed | 500g | 5660.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A315456 |
2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]acetic acid (CAS 166108-71-0) is a chemical compound with the molecular formula C21H23NO6 and a molecular weight of 385.4 g/mol. IUPAC name: 2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]acetic acid. InChIKey: XQPYRJIMPDBGRW-UHFFFAOYSA-N.
| Molecular formula | C21H23NO6 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | 2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]acetic acid |
| InChIKey | XQPYRJIMPDBGRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCC(=O)O |
Computed by PubChem (NCBI)