Products 105299-31-8

CAS 105299-31-8 is the registry number for 1-benzyl 5-methyl (2S)-2-{[(benzyloxy)carbonyl]amino}pentanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

1-O-benzyl 5-O-methyl (2S)-2-(phenylmethoxycarbonylamino)pentanedioate (CAS 105299-31-8) is a chemical compound with the molecular formula C21H23NO6 and a molecular weight of 385.4 g/mol. IUPAC name: 1-O-benzyl 5-O-methyl (2S)-2-(phenylmethoxycarbonylamino)pentanedioate. InChIKey: FJCVKTNOERGECM-SFHVURJKSA-N.

Identity
Molecular formulaC21H23NO6
Molecular weight385.4 g/mol
IUPAC name1-O-benzyl 5-O-methyl (2S)-2-(phenylmethoxycarbonylamino)pentanedioate
InChIKeyFJCVKTNOERGECM-SFHVURJKSA-N
SMILESCOC(=O)CC[C@@H](C(=O)OCC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)