CAS 7336-33-6 appears in our catalog under these names: Colchicine Impurity 5(Colchicine EP Impurity E), Colchicine EP Impurity E, 3-Demethyl Colchicine, >95% (HPLC), N-((7S,12aRa)-3-Hydroxy-1,2,10-trimethoxy-9-oxo-5,6,7,9-tetrahydrobenzo(a)heptalen-7-yl)acetamide (3-O-Demethylcolchicine), 3–Demethylcolchicine. Offered by: Hubei YoungXin, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 5mg, 2mg.
N-[(7S)-3-hydroxy-1,2,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide (CAS 7336-33-6) is a chemical compound with the molecular formula C21H23NO6 and a molecular weight of 385.4 g/mol. IUPAC name: N-[(7S)-3-hydroxy-1,2,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide. InChIKey: JRRUSQGIRBEMRN-HNNXBMFYSA-N.
| Molecular formula | C21H23NO6 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | N-[(7S)-3-hydroxy-1,2,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
| InChIKey | JRRUSQGIRBEMRN-HNNXBMFYSA-N |
| SMILES | CC(=O)N[C@H]1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)O |
Computed by PubChem (NCBI)