cas: 91000-69-0 — see every product listed under this CAS number, including other names
Fmoc-Arg-OH 97% (CAS 91000-69-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A273522-1g |
| cas | 91000-69-0 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 648.50 Pln | |
| Ambeed | 500g | 2662.12 Pln | |
| Ambeed | 1000g | 4481.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A273522 |
(2S)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 91000-69-0) is a chemical compound with the molecular formula C21H24N4O4 and a molecular weight of 396.4 g/mol. IUPAC name: (2S)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: DVBUCBXGDWWXNY-SFHVURJKSA-N.
| Molecular formula | C21H24N4O4 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | (2S)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | DVBUCBXGDWWXNY-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
Computed by PubChem (NCBI)