cas: 91000-69-0 — see every product listed under this CAS number, including other names
Fmoc-Arg-OH, 99.98% (CAS 91000-69-0) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 50 g, 1 g, 100 g, 5 g, 10mM/1mL, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W013750-25 g |
| cas | 91000-69-0 |
| size | 25 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 695.86 Pln | |
| MedChemExpress | 50 g | 928.06 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 100 g | 1248.49 Pln | |
| MedChemExpress | 5 g | 361.49 Pln | |
| MedChemExpress | 10mM/1mL | 254.68 Pln | |
| MedChemExpress | 10 g | 477.59 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.98% |
(2S)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 91000-69-0) is a chemical compound with the molecular formula C21H24N4O4 and a molecular weight of 396.4 g/mol. IUPAC name: (2S)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: DVBUCBXGDWWXNY-SFHVURJKSA-N.
| Molecular formula | C21H24N4O4 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | (2S)-5-(diaminomethylideneamino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | DVBUCBXGDWWXNY-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
Computed by PubChem (NCBI)