cas: 276869-41-1 — see every product listed under this CAS number, including other names
Fmoc-Asu(OtBu)-OH 97% (CAS 276869-41-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100027-100mg |
| cas | 276869-41-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 843.19 Pln | |
| Ambeed | 5g | 2968.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A100027 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(2-methylpropan-2-yl)oxy]-8-oxooctanoic acid (CAS 276869-41-1) is a chemical compound with the molecular formula C27H33NO6 and a molecular weight of 467.6 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(2-methylpropan-2-yl)oxy]-8-oxooctanoic acid. InChIKey: ULPCAXORIFXUMN-QHCPKHFHSA-N.
| Molecular formula | C27H33NO6 |
|---|---|
| Molecular weight | 467.6 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-8-[(2-methylpropan-2-yl)oxy]-8-oxooctanoic acid |
| InChIKey | ULPCAXORIFXUMN-QHCPKHFHSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)