CAS 1310680-40-0 appears in our catalog under these names: Fmoc-d-beta-methylisoleucine, 95%, Fmoc-beta-Me-D-Ile-OH, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3,3-dimethyl-D-norvaline, ≥95%, ≥95%, Fmoc-D-β-Me-D-Ile-OH, 98%. Offered by: Combi-blocks, Iris Biotech, Chemat, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylpentanoic acid (CAS 1310680-40-0) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylpentanoic acid. InChIKey: KTFMEQGAIAYJMN-IBGZPJMESA-N.
| Molecular formula | C22H25NO4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylpentanoic acid |
| InChIKey | KTFMEQGAIAYJMN-IBGZPJMESA-N |
| SMILES | CCC(C)(C)[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)