CAS 173690-47-6 appears in our catalog under these names: 6-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)hexanoic acid, 95%, 6–((((9H–Fluoren–9–yl)methoxy)carbonyl)(methyl)amino)hexanoic acid, 6-({((9H-fluoren-9-yl)methoxy)carbonyl}(methyl)amino)hexanoic acid, 6-(N-Fmoc-N-methyl-amino)hexanoic acid 97%, 6-[[(9H-Fluoren-9-ylmethoxy)carbonyl](methyl)amino]hexanoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 0,5g, 10g, 100 mg, 250 mg.
6-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]hexanoic acid (CAS 173690-47-6) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: 6-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]hexanoic acid. InChIKey: PNRDWMGJZQEECF-UHFFFAOYSA-N.
| Molecular formula | C22H25NO4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 6-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]hexanoic acid |
| InChIKey | PNRDWMGJZQEECF-UHFFFAOYSA-N |
| SMILES | CN(CCCCCC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)