cas: 180570-71-2 — see every product listed under this CAS number, including other names
Fmoc-D-Asn(Trt)-OH 97% (CAS 180570-71-2) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A128604-1000g |
| cas | 180570-71-2 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 10388.44 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 5g | 209.06 Pln | |
| Ambeed | 10g | 270.25 Pln | |
| Ambeed | 25g | 565.06 Pln | |
| Ambeed | 100g | 1599.69 Pln | |
| Ambeed | 500g | 6516.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A128604 |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoic acid (CAS 180570-71-2) is a chemical compound with the molecular formula C38H32N2O5 and a molecular weight of 596.7 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoic acid. InChIKey: KJYAFJQCGPUXJY-UUWRZZSWSA-N.
| Molecular formula | C38H32N2O5 |
|---|---|
| Molecular weight | 596.7 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoic acid |
| InChIKey | KJYAFJQCGPUXJY-UUWRZZSWSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)C[C@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)