CAS 1623073-71-1 is the registry number for Antiplatelet agent 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]phenyl]benzoic acid (CAS 1623073-71-1) is a chemical compound with the molecular formula C38H32N2O5 and a molecular weight of 596.7 g/mol. IUPAC name: 2-[4-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]phenyl]benzoic acid. InChIKey: LMRCJUMRLLJOCP-UHFFFAOYSA-N.
| Molecular formula | C38H32N2O5 |
|---|---|
| Molecular weight | 596.7 g/mol |
| IUPAC name | 2-[4-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]phenyl]benzoic acid |
| InChIKey | LMRCJUMRLLJOCP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(N(C(=N2)C3=CC=C(C=C3)OC)CC4=CC=C(C=C4)C5=CC=CC=C5C(=O)O)C6=CC=C(C=C6)OC |
Computed by PubChem (NCBI)