CAS 180570-71-2 appears in our catalog under these names: Fmoc-d-asn(trt)-oh, >95% (HPLC), Fmoc–D–Asn(Trt)–OH, Fmoc-D-Asn(Trt)-OH, Fmoc-D-Asn(Trt)-OH 97%, FMOC-D-ASN(TRT)-OH, 97%. Offered by: TRC, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 100mg, 25g, 5g, 100g, 250g, 1g, 2g, 10g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoic acid (CAS 180570-71-2) is a chemical compound with the molecular formula C38H32N2O5 and a molecular weight of 596.7 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoic acid. InChIKey: KJYAFJQCGPUXJY-UUWRZZSWSA-N.
| Molecular formula | C38H32N2O5 |
|---|---|
| Molecular weight | 596.7 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-(tritylamino)butanoic acid |
| InChIKey | KJYAFJQCGPUXJY-UUWRZZSWSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)C[C@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)