cas: 167015-11-4 — see every product listed under this CAS number, including other names
Fmoc-D-Cys(Trt)-OH, 98% (CAS 167015-11-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118WC5-1g |
| cas | 167015-11-4 |
| size | 1g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 50g | 198.80 Pln | |
| Chemat | 100g | 338.00 Pln | |
| Chemat | 250g | 722.00 Pln | |
| Chemat | 500g | 1440.00 Pln | |
| Chemat | 1kg | 1797.20 Pln | |
| Chemat | 5kg | 9326.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid (CAS 167015-11-4) is a chemical compound with the molecular formula C37H31NO4S and a molecular weight of 585.7 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid. InChIKey: KLBPUVPNPAJWHZ-UUWRZZSWSA-N.
| Molecular formula | C37H31NO4S |
|---|---|
| Molecular weight | 585.7 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid |
| InChIKey | KLBPUVPNPAJWHZ-UUWRZZSWSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SC[C@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)