CAS 360565-11-3 appears in our catalog under these names: Fmoc–Cys(Trt)–OH–d2, Fmoc-Cys(Trt)-OH-d2, 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 1 mg, 50 mg, 10 mg, 25 mg.
(2R)-3,3-dideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid (CAS 360565-11-3) is a chemical compound with the molecular formula C37H31NO4S and a molecular weight of 587.7 g/mol. IUPAC name: (2R)-3,3-dideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid. InChIKey: KLBPUVPNPAJWHZ-YCOHJDIPSA-N.
| Molecular formula | C37H31NO4S |
|---|---|
| Molecular weight | 587.7 g/mol |
| IUPAC name | (2R)-3,3-dideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid |
| InChIKey | KLBPUVPNPAJWHZ-YCOHJDIPSA-N |
| SMILES | [2H]C([2H])([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)SC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)