CAS 360795-94-4 is the registry number for Fmoc-Cys(Trt)-OH-1,2,3-13C3,15N, 98.7%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 1 mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-tritylsulfanyl(1,2,3-13C3)propanoic acid (CAS 360795-94-4) is a chemical compound with the molecular formula C37H31NO4S and a molecular weight of 589.7 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-tritylsulfanyl(1,2,3-13C3)propanoic acid. InChIKey: KLBPUVPNPAJWHZ-OUVSSECZSA-N.
| Molecular formula | C37H31NO4S |
|---|---|
| Molecular weight | 589.7 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-tritylsulfanyl(1,2,3-13C3)propanoic acid |
| InChIKey | KLBPUVPNPAJWHZ-OUVSSECZSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)S[13CH2][13C@@H]([13C](=O)O)[15NH]C(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)