cas: 214750-75-1 — see every product listed under this CAS number, including other names
Fmoc-D-Lys(Aloc)-OH, 95% (CAS 214750-75-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F556421-1G |
| cas | 214750-75-1 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 10g | 211.40 Pln | |
| Fluorochem | 25g | 362.39 Pln | |
| Fluorochem | 100g | 1070.47 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 203.60 Pln | |
| Chemat | 25g | 381.20 Pln | |
| Chemat | 100g | 1130.00 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid (CAS 214750-75-1) is a chemical compound with the molecular formula C25H28N2O6 and a molecular weight of 452.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid. InChIKey: OJBNDXHENJDCBA-JOCHJYFZSA-N.
| Molecular formula | C25H28N2O6 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid |
| InChIKey | OJBNDXHENJDCBA-JOCHJYFZSA-N |
| SMILES | C=CCOC(=O)NCCCC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)