Products 2350405-99-9

CAS 2350405-99-9 is the registry number for (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)oct-7-ynoic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)oct-7-ynoic acid (CAS 2350405-99-9) is a chemical compound with the molecular formula C23H23NO4 and a molecular weight of 377.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)oct-7-ynoic acid. InChIKey: JGAAQTGBSLHOGR-OAQYLSRUSA-N.

Identity
Molecular formulaC23H23NO4
Molecular weight377.4 g/mol
IUPAC name(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)oct-7-ynoic acid
InChIKeyJGAAQTGBSLHOGR-OAQYLSRUSA-N
SMILESC#CCCCC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)